C27H36O4SSi — CID 134901496
methyl (6Z,10R,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-10-methyl-11-phenylsulfanyltrideca-6,11-dien-4,8-diynoate (PubChem CID 134901496) has the molecular formula C27H36O4SSi and a molecular weight of 484.73 g/mol. Its IUPAC name is methyl (6Z,10R,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-10-methyl-11-phenylsulfanyltrideca-6,11-dien-4,8-diynoate.
| Compound Name | methyl (6Z,10R,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-10-methyl-11-phenylsulfanyltrideca-6,11-dien-4,8-diynoate |
|---|---|
| PubChem CID | 134901496 |
| Molecular Formula | C27H36O4SSi |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl (6Z,10R,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-10-methyl-11-phenylsulfanyltrideca-6,11-dien-4,8-diynoate |
| SMILES | COC(=O)CCC#C/C=C\C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)/C(=C/CO)Sc1ccccc1 |
| InChI | InChI=1S/C27H36O4SSi/c1-26(2,3)33(6,7)31-27(4,21-16-11-9-8-10-15-19-25(29)30-5)24(20-22-28)32-23-17-13-12-14-18-23/h9,11-14,17-18,20,28H,15,19,22H2,1-7H3/b11-9-,24-20-/t27-/m1/s1 |
| InChIKey | LALIRNGMVSURTD-DZSYMJGHSA-N |
| XLogP | 5.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|