About CID 134901566
CID 134901566 (PubChem CID 134901566) has the molecular formula C20H39O2Si
and a molecular weight of 339.62 g/mol.
Molecular Properties
| Compound Name | CID 134901566 |
| PubChem CID | 134901566 |
| Molecular Formula | C20H39O2Si |
| Molecular Weight | 339.62 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | — |
| SMILES | CCC[Si](/C=C/CCCCCCCOC1CCCCO1)CCC |
| InChI | InChI=1S/C20H39O2Si/c1-3-17-23(18-4-2)19-13-9-7-5-6-8-11-15-21-20-14-10-12-16-22-20/h13,19-20H,3-12,14-18H2,1-2H3/b19-13+ |
| InChIKey | HSQCASBFRMNJDJ-CPNJWEJPSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134901566 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134901566?
The IUPAC name of CID 134901566 (CID 134901566) is not available.
What is the SMILES notation for CID 134901566?
The canonical SMILES for CID 134901566 is CCC[Si](/C=C/CCCCCCCOC1CCCCO1)CCC.
What is the InChIKey of CID 134901566?
The InChIKey is HSQCASBFRMNJDJ-CPNJWEJPSA-N. The full InChI is InChI=1S/C20H39O2Si/c1-3-17-23(18-4-2)19-13-9-7-5-6-8-11-15-21-20-14-10-12-16-22-20/h13,19-20H,3-12,14-18H2,1-2H3/b19-13+.
What are the key properties of CID 134901566?
CID 134901566 has a molecular weight of 339.62 g/mol, XLogP of 6.28, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134901566 is sourced from PubChem (CID 134901566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).