C22H33ClHgO3S — CID 134901813
[(1S,3S,4S)-3-[(E)-5-benzylsulfonyl-3-methylpent-3-enyl]-4-hydroxy-2,2,4-trimethylcyclohexyl]-chloromercury (PubChem CID 134901813) has the molecular formula C22H33ClHgO3S and a molecular weight of 613.61 g/mol. Its IUPAC name is [(1S,3S,4S)-3-[(E)-5-benzylsulfonyl-3-methylpent-3-enyl]-4-hydroxy-2,2,4-trimethylcyclohexyl]-chloromercury.
| Compound Name | [(1S,3S,4S)-3-[(E)-5-benzylsulfonyl-3-methylpent-3-enyl]-4-hydroxy-2,2,4-trimethylcyclohexyl]-chloromercury |
|---|---|
| PubChem CID | 134901813 |
| Molecular Formula | C22H33ClHgO3S |
| Molecular Weight | 613.61 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | [(1S,3S,4S)-3-[(E)-5-benzylsulfonyl-3-methylpent-3-enyl]-4-hydroxy-2,2,4-trimethylcyclohexyl]-chloromercury |
| SMILES | C/C(=C\CS(=O)(=O)Cc1ccccc1)CC[C@H]1C(C)(C)[C@@H]([Hg]Cl)CC[C@]1(C)O |
| InChI | InChI=1S/C22H33O3S.ClH.Hg/c1-18(11-12-20-21(2,3)14-8-15-22(20,4)23)13-16-26(24,25)17-19-9-6-5-7-10-19;;/h5-7,9-10,13-14,20,23H,8,11-12,15-17H2,1-4H3;1H;/q;;+1/p-1/b18-13+;;/t20-,22-;;/m0../s1 |
| InChIKey | UDRGWCVBBUGGQP-QRSXUSPWSA-M |
| XLogP | 5.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|