C19H23N3O4 — CID 134901970
tert-butyl N-[(2S)-1-(cyanomethylamino)-5-(2-methoxyphenyl)-1-oxopent-4-yn-2-yl]carbamate (PubChem CID 134901970) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(cyanomethylamino)-5-(2-methoxyphenyl)-1-oxopent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(cyanomethylamino)-5-(2-methoxyphenyl)-1-oxopent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 134901970 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-(cyanomethylamino)-5-(2-methoxyphenyl)-1-oxopent-4-yn-2-yl]carbamate |
| SMILES | COc1ccccc1C#CC[C@H](NC(=O)OC(C)(C)C)C(=O)NCC#N |
| InChI | InChI=1S/C19H23N3O4/c1-19(2,3)26-18(24)22-15(17(23)21-13-12-20)10-7-9-14-8-5-6-11-16(14)25-4/h5-6,8,11,15H,10,13H2,1-4H3,(H,21,23)(H,22,24)/t15-/m0/s1 |
| InChIKey | GFFYVTSSLKMLHW-HNNXBMFYSA-N |
| XLogP | 1.97 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|