About CID 134903182
CID 134903182 (PubChem CID 134903182) has the molecular formula C20H22Cl2Ti
and a molecular weight of 381.17 g/mol.
Molecular Properties
| Compound Name | CID 134903182 |
| PubChem CID | 134903182 |
| Molecular Formula | C20H22Cl2Ti |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C](C(C)[C]2[CH][CH][C]3C=CC=C[C]32)[C]1C.Cl[Ti]Cl |
| InChI | InChI=1S/C20H22.2ClH.Ti/c1-12-13(2)15(4)20(14(12)3)16(5)18-11-10-17-8-6-7-9-19(17)18;;;/h6-11,16H,1-5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MAMGXYVXVGWFBR-UHFFFAOYSA-L |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 134903182 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134903182?
The IUPAC name of CID 134903182 (CID 134903182) is not available.
What is the SMILES notation for CID 134903182?
The canonical SMILES for CID 134903182 is C[C]1[C](C)[C](C)[C](C(C)[C]2[CH][CH][C]3C=CC=C[C]32)[C]1C.Cl[Ti]Cl.
What is the InChIKey of CID 134903182?
The InChIKey is MAMGXYVXVGWFBR-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H22.2ClH.Ti/c1-12-13(2)15(4)20(14(12)3)16(5)18-11-10-17-8-6-7-9-19(17)18;;;/h6-11,16H,1-5H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 134903182?
CID 134903182 has a molecular weight of 381.17 g/mol, XLogP of 6.24, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134903182 is sourced from PubChem (CID 134903182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).