C12H14O6S2 — CID 13490331
bis(prop-2-enyl) 2-(4,5-dihydroxy-1,3-dithiolan-2-ylidene)propanedioate (PubChem CID 13490331) has the molecular formula C12H14O6S2 and a molecular weight of 318.37 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-(4,5-dihydroxy-1,3-dithiolan-2-ylidene)propanedioate.
| Compound Name | bis(prop-2-enyl) 2-(4,5-dihydroxy-1,3-dithiolan-2-ylidene)propanedioate |
|---|---|
| PubChem CID | 13490331 |
| Molecular Formula | C12H14O6S2 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | bis(prop-2-enyl) 2-(4,5-dihydroxy-1,3-dithiolan-2-ylidene)propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OCC=C)=C1SC(O)C(O)S1 |
| InChI | InChI=1S/C12H14O6S2/c1-3-5-17-8(13)7(9(14)18-6-4-2)12-19-10(15)11(16)20-12/h3-4,10-11,15-16H,1-2,5-6H2 |
| InChIKey | ZKXWMFQVQZHRAV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|