C17H29BO3 — CID 134903370
3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclohex-2-en-1-one (PubChem CID 134903370) has the molecular formula C17H29BO3 and a molecular weight of 292.23 g/mol. Its IUPAC name is 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclohex-2-en-1-one.
| Compound Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134903370 |
| Molecular Formula | C17H29BO3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclohex-2-en-1-one |
| SMILES | CC1(C)OB(CCCCCC2=CC(=O)CCC2)OC1(C)C |
| InChI | InChI=1S/C17H29BO3/c1-16(2)17(3,4)21-18(20-16)12-7-5-6-9-14-10-8-11-15(19)13-14/h13H,5-12H2,1-4H3 |
| InChIKey | QXBYBHXMGRAIAR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|