C12H21BO6S — CID 134903459
2-[2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethylsulfanyl]butanedioic acid (PubChem CID 134903459) has the molecular formula C12H21BO6S and a molecular weight of 304.17 g/mol. Its IUPAC name is 2-[2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethylsulfanyl]butanedioic acid.
| Compound Name | 2-[2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethylsulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 134903459 |
| Molecular Formula | C12H21BO6S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethylsulfanyl]butanedioic acid |
| SMILES | CC1CC(C)(C)OB(CCSC(CC(=O)O)C(=O)O)O1 |
| InChI | InChI=1S/C12H21BO6S/c1-8-7-12(2,3)19-13(18-8)4-5-20-9(11(16)17)6-10(14)15/h8-9H,4-7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | NVXDENBMSULWNY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|