C15H28O2 — CID 134903572
(1R,2R)-1-cyclohexyl-4-methyl-2-prop-1-en-2-ylpentane-1,3-diol (PubChem CID 134903572) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1R,2R)-1-cyclohexyl-4-methyl-2-prop-1-en-2-ylpentane-1,3-diol.
| Compound Name | (1R,2R)-1-cyclohexyl-4-methyl-2-prop-1-en-2-ylpentane-1,3-diol |
|---|---|
| PubChem CID | 134903572 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (1R,2R)-1-cyclohexyl-4-methyl-2-prop-1-en-2-ylpentane-1,3-diol |
| SMILES | C=C(C)[C@H](C(O)C(C)C)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C15H28O2/c1-10(2)13(14(16)11(3)4)15(17)12-8-6-5-7-9-12/h11-17H,1,5-9H2,2-4H3/t13-,14?,15-/m1/s1 |
| InChIKey | RWRYLSDRPWCZMB-GIJJTGMTSA-N |
| XLogP | 3.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|