C8H17BO — CID 134903588
1,2,2,3,4-pentamethyl-1-oxonia-2-boranuidacyclopent-3-ene (PubChem CID 134903588) has the molecular formula C8H17BO and a molecular weight of 140.03 g/mol. Its IUPAC name is 1,2,2,3,4-pentamethyl-1-oxonia-2-boranuidacyclopent-3-ene.
| Compound Name | 1,2,2,3,4-pentamethyl-1-oxonia-2-boranuidacyclopent-3-ene |
|---|---|
| PubChem CID | 134903588 |
| Molecular Formula | C8H17BO |
| Molecular Weight | 140.03 g/mol |
| Exact Mass | 140.14 |
| IUPAC Name | 1,2,2,3,4-pentamethyl-1-oxonia-2-boranuidacyclopent-3-ene |
| SMILES | CC1=C(C)[B-](C)(C)[O+](C)C1 |
| InChI | InChI=1S/C8H17BO/c1-7-6-10(5)9(3,4)8(7)2/h6H2,1-5H3 |
| InChIKey | IQVJUUVWTINRCJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.03 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|