C22H48B2Pb2 — CID 134903635
[(3E,5E)-3,6-bis(diethylboranyl)-5-trimethylplumbylocta-3,5-dien-4-yl]-trimethylplumbane (PubChem CID 134903635) has the molecular formula C22H48B2Pb2 and a molecular weight of 748.65 g/mol. Its IUPAC name is [(3E,5E)-3,6-bis(diethylboranyl)-5-trimethylplumbylocta-3,5-dien-4-yl]-trimethylplumbane.
| Compound Name | [(3E,5E)-3,6-bis(diethylboranyl)-5-trimethylplumbylocta-3,5-dien-4-yl]-trimethylplumbane |
|---|---|
| PubChem CID | 134903635 |
| Molecular Formula | C22H48B2Pb2 |
| Molecular Weight | 748.65 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | [(3E,5E)-3,6-bis(diethylboranyl)-5-trimethylplumbylocta-3,5-dien-4-yl]-trimethylplumbane |
| SMILES | CCB(CC)/C(CC)=C(C(=C(\CC)B(CC)CC)/[Pb](C)(C)C)\[Pb](C)(C)C |
| InChI | InChI=1S/C16H30B2.6CH3.2Pb/c1-7-15(17(9-3)10-4)13-14-16(8-2)18(11-5)12-6;;;;;;;;/h7-12H2,1-6H3;6*1H3;; |
| InChIKey | IWYORIBFEPVPTJ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.65 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|