About [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane
[(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane (PubChem CID 134903887) has the molecular formula C27H31BO2Si
and a molecular weight of 426.44 g/mol. Its IUPAC name is [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane.
Molecular Properties
| Compound Name | [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane |
| PubChem CID | 134903887 |
| Molecular Formula | C27H31BO2Si |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane |
| SMILES | CCCCCC/C(=C/B1Oc2ccccc2O1)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31BO2Si/c1-3-4-5-8-19-25(22-28-29-26-20-13-14-21-27(26)30-28)31(2,23-15-9-6-10-16-23)24-17-11-7-12-18-24/h6-7,9-18,20-22H,3-5,8,19H2,1-2H3/b25-22- |
| InChIKey | UICRAZJHHQRNOQ-LVWGJNHUSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane?
The IUPAC name of [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane (CID 134903887) is [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane.
What is the SMILES notation for [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane?
The canonical SMILES for [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane is CCCCCC/C(=C/B1Oc2ccccc2O1)[Si](C)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane?
The InChIKey is UICRAZJHHQRNOQ-LVWGJNHUSA-N. The full InChI is InChI=1S/C27H31BO2Si/c1-3-4-5-8-19-25(22-28-29-26-20-13-14-21-27(26)30-28)31(2,23-15-9-6-10-16-23)24-17-11-7-12-18-24/h6-7,9-18,20-22H,3-5,8,19H2,1-2H3/b25-22-.
What are the key properties of [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane?
[(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane has a molecular weight of 426.44 g/mol, XLogP of 5.81, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-(1,3,2-benzodioxaborol-2-yl)oct-1-en-2-yl]-methyl-diphenylsilane is sourced from PubChem (CID 134903887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).