About S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate
S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate (PubChem CID 134904174) has the molecular formula C16H34O3SSi
and a molecular weight of 334.60 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate.
Molecular Properties
| Compound Name | S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate |
| PubChem CID | 134904174 |
| Molecular Formula | C16H34O3SSi |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate |
| SMILES | CC(C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C16H34O3SSi/c1-11(2)12(17)13(14(18)20-15(3,4)5)19-21(9,10)16(6,7)8/h11-13,17H,1-10H3/t12-,13-/m0/s1 |
| InChIKey | HFSQOTFZNJYRMJ-STQMWFEESA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate?
The IUPAC name of S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate (CID 134904174) is S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate.
What is the SMILES notation for S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate?
The canonical SMILES for S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate is CC(C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)SC(C)(C)C.
What is the InChIKey of S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate?
The InChIKey is HFSQOTFZNJYRMJ-STQMWFEESA-N. The full InChI is InChI=1S/C16H34O3SSi/c1-11(2)12(17)13(14(18)20-15(3,4)5)19-21(9,10)16(6,7)8/h11-13,17H,1-10H3/t12-,13-/m0/s1.
What are the key properties of S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate?
S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate has a molecular weight of 334.60 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-methylpentanethioate is sourced from PubChem (CID 134904174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).