C34H34B4O8Si2 — CID 134904208
trimethyl-[(1Z,3Z)-1,2,3,4-tetrakis(1,3,2-benzodioxaborol-2-yl)-4-trimethylsilylbuta-1,3-dienyl]silane (PubChem CID 134904208) has the molecular formula C34H34B4O8Si2 and a molecular weight of 670.06 g/mol. Its IUPAC name is trimethyl-[(1Z,3Z)-1,2,3,4-tetrakis(1,3,2-benzodioxaborol-2-yl)-4-trimethylsilylbuta-1,3-dienyl]silane.
| Compound Name | trimethyl-[(1Z,3Z)-1,2,3,4-tetrakis(1,3,2-benzodioxaborol-2-yl)-4-trimethylsilylbuta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 134904208 |
| Molecular Formula | C34H34B4O8Si2 |
| Molecular Weight | 670.06 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | trimethyl-[(1Z,3Z)-1,2,3,4-tetrakis(1,3,2-benzodioxaborol-2-yl)-4-trimethylsilylbuta-1,3-dienyl]silane |
| SMILES | C[Si](C)(C)/C(B1Oc2ccccc2O1)=C(B1Oc2ccccc2O1)\C(B1Oc2ccccc2O1)=C(\B1Oc2ccccc2O1)[Si](C)(C)C |
| InChI | InChI=1S/C34H34B4O8Si2/c1-47(2,3)33(37-43-27-19-11-12-20-28(27)44-37)31(35-39-23-15-7-8-16-24(23)40-35)32(36-41-25-17-9-10-18-26(25)42-36)34(48(4,5)6)38-45-29-21-13-14-22-30(29)46-38/h7-22H,1-6H3/b33-31+,34-32+ |
| InChIKey | HTUHPHSWVLJCOS-FMWAKIAMSA-N |
| XLogP | 7.33 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.06 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|