About (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol
(4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol (PubChem CID 134904251) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol.
Molecular Properties
| Compound Name | (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol |
| PubChem CID | 134904251 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol |
| SMILES | C#CC[C@H](O)C[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C13H22O/c1-5-7-13(14)10-12(4)9-6-8-11(2)3/h1,8,12-14H,6-7,9-10H2,2-4H3/t12-,13-/m0/s1 |
| InChIKey | OKGPEBZTEAPYEV-STQMWFEESA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol?
The IUPAC name of (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol (CID 134904251) is (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol.
What is the SMILES notation for (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol?
The canonical SMILES for (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol is C#CC[C@H](O)C[C@@H](C)CCC=C(C)C.
What is the InChIKey of (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol?
The InChIKey is OKGPEBZTEAPYEV-STQMWFEESA-N. The full InChI is InChI=1S/C13H22O/c1-5-7-13(14)10-12(4)9-6-8-11(2)3/h1,8,12-14H,6-7,9-10H2,2-4H3/t12-,13-/m0/s1.
What are the key properties of (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol?
(4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol has a molecular weight of 194.32 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-6,10-dimethylundec-9-en-1-yn-4-ol is sourced from PubChem (CID 134904251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).