About CID 134904447
CID 134904447 (PubChem CID 134904447) has the molecular formula C3H6BN2-
and a molecular weight of 80.91 g/mol.
Molecular Properties
| Compound Name | CID 134904447 |
| PubChem CID | 134904447 |
| Molecular Formula | C3H6BN2- |
| Molecular Weight | 80.91 g/mol |
| Exact Mass | 81.06 |
| IUPAC Name | — |
| SMILES | CN(C)[B-]C#N |
| InChI | InChI=1S/C3H6BN2/c1-6(2)4-3-5/h1-2H3/q-1 |
| InChIKey | RITQZNZPDSKQTK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.91 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134904447 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134904447?
The IUPAC name of CID 134904447 (CID 134904447) is not available.
What is the SMILES notation for CID 134904447?
The canonical SMILES for CID 134904447 is CN(C)[B-]C#N.
What is the InChIKey of CID 134904447?
The InChIKey is RITQZNZPDSKQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BN2/c1-6(2)4-3-5/h1-2H3/q-1.
What are the key properties of CID 134904447?
CID 134904447 has a molecular weight of 80.91 g/mol, XLogP of -0.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134904447 is sourced from PubChem (CID 134904447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).