C22H42B2O4 — CID 134904498
4,4,5,5-tetramethyl-2-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]octyl]-1,3,2-dioxaborolane (PubChem CID 134904498) has the molecular formula C22H42B2O4 and a molecular weight of 392.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]octyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]octyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904498 |
| Molecular Formula | C22H42B2O4 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]octyl]-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C(CCCCCC)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H42B2O4/c1-11-12-13-14-15-18(16-23-25-19(3,4)20(5,6)26-23)17(2)24-27-21(7,8)22(9,10)28-24/h18H,2,11-16H2,1,3-10H3 |
| InChIKey | OXWPLODTZAORPN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|