C25H29NO5 — CID 134904506
(4R,5S)-3-[(2R,3S)-3-hydroxy-6-methyl-2-phenylmethoxyhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 134904506) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S)-3-hydroxy-6-methyl-2-phenylmethoxyhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S)-3-hydroxy-6-methyl-2-phenylmethoxyhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134904506 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (4R,5S)-3-[(2R,3S)-3-hydroxy-6-methyl-2-phenylmethoxyhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)CC[C@H](O)[C@@H](OCc1ccccc1)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C25H29NO5/c1-17(2)14-15-21(27)23(30-16-19-10-6-4-7-11-19)24(28)26-18(3)22(31-25(26)29)20-12-8-5-9-13-20/h4-13,18,21-23,27H,1,14-16H2,2-3H3/t18-,21+,22-,23-/m1/s1 |
| InChIKey | GFCMDRZAXAVPQV-YJSIEXFISA-N |
| XLogP | 4.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|