C20H27NO5 — CID 134904594
(2S,4R,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethylheptane-1,3-dione (PubChem CID 134904594) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2S,4R,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethylheptane-1,3-dione.
| Compound Name | (2S,4R,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethylheptane-1,3-dione |
|---|---|
| PubChem CID | 134904594 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (2S,4R,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4,6-trimethylheptane-1,3-dione |
| SMILES | CC(C)[C@@H](O)[C@@H](C)C(=O)[C@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO5/c1-12(2)17(22)13(3)18(23)14(4)19(24)21-16(11-26-20(21)25)10-15-8-6-5-7-9-15/h5-9,12-14,16-17,22H,10-11H2,1-4H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | STKSPHCXLWQTNX-YALNPMBYSA-N |
| XLogP | 2.43 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|