About 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine
2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine (PubChem CID 134904792) has the molecular formula C45H42FGeN
and a molecular weight of 688.45 g/mol. Its IUPAC name is 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine.
Molecular Properties
| Compound Name | 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine |
| PubChem CID | 134904792 |
| Molecular Formula | C45H42FGeN |
| Molecular Weight | 688.45 g/mol |
| Exact Mass | 689.25 |
| IUPAC Name | 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine |
| SMILES | Cc1cc(C)c([Ge](F)(C(=C=NC(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C45H42FGeN/c1-32-27-34(3)43(35(4)28-32)47(46,44-36(5)29-33(2)30-37(44)6)42(38-19-11-7-12-20-38)31-48-45(39-21-13-8-14-22-39,40-23-15-9-16-24-40)41-25-17-10-18-26-41/h7-30H,1-6H3 |
| InChIKey | OAKGHJVLMWPZDY-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 688.45 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine?
The IUPAC name of 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine (CID 134904792) is 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine.
What is the SMILES notation for 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine?
The canonical SMILES for 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine is Cc1cc(C)c([Ge](F)(C(=C=NC(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine?
The InChIKey is OAKGHJVLMWPZDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H42FGeN/c1-32-27-34(3)43(35(4)28-32)47(46,44-36(5)29-33(2)30-37(44)6)42(38-19-11-7-12-20-38)31-48-45(39-21-13-8-14-22-39,40-23-15-9-16-24-40)41-25-17-10-18-26-41/h7-30H,1-6H3.
What are the key properties of 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine?
2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine has a molecular weight of 688.45 g/mol, XLogP of 9.85, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[fluoro-bis(2,4,6-trimethylphenyl)germyl]-2-phenyl-N-tritylethenimine is sourced from PubChem (CID 134904792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).