C23H46O2SiSn — CID 134904819
ethyl (2Z)-2-(tributylstannylmethylidene)-4-trimethylsilylpent-4-enoate (PubChem CID 134904819) has the molecular formula C23H46O2SiSn and a molecular weight of 501.42 g/mol. Its IUPAC name is ethyl (2Z)-2-(tributylstannylmethylidene)-4-trimethylsilylpent-4-enoate.
| Compound Name | ethyl (2Z)-2-(tributylstannylmethylidene)-4-trimethylsilylpent-4-enoate |
|---|---|
| PubChem CID | 134904819 |
| Molecular Formula | C23H46O2SiSn |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | ethyl (2Z)-2-(tributylstannylmethylidene)-4-trimethylsilylpent-4-enoate |
| SMILES | C=C(C/C(=C/[Sn](CCCC)(CCCC)CCCC)C(=O)OCC)[Si](C)(C)C |
| InChI | InChI=1S/C11H19O2Si.3C4H9.Sn/c1-7-13-11(12)9(2)8-10(3)14(4,5)6;3*1-3-4-2;/h2H,3,7-8H2,1,4-6H3;3*1,3-4H2,2H3; |
| InChIKey | KTRYACIRTBNVOO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|