C16H24O2 — CID 134905091
(5R,6R)-8-ethoxy-6-methyl-3-propan-2-ylidenespiro[4.5]dec-8-en-10-one (PubChem CID 134905091) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (5R,6R)-8-ethoxy-6-methyl-3-propan-2-ylidenespiro[4.5]dec-8-en-10-one.
| Compound Name | (5R,6R)-8-ethoxy-6-methyl-3-propan-2-ylidenespiro[4.5]dec-8-en-10-one |
|---|---|
| PubChem CID | 134905091 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (5R,6R)-8-ethoxy-6-methyl-3-propan-2-ylidenespiro[4.5]dec-8-en-10-one |
| SMILES | CCOC1=CC(=O)[C@@]2(CCC(=C(C)C)C2)[C@H](C)C1 |
| InChI | InChI=1S/C16H24O2/c1-5-18-14-8-12(4)16(15(17)9-14)7-6-13(10-16)11(2)3/h9,12H,5-8,10H2,1-4H3/t12-,16-/m1/s1 |
| InChIKey | DVBLQAKIZMOSTN-MLGOLLRUSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|