C9H12F3NO3 — CID 134905097
methyl (2R,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 134905097) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is methyl (2R,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | methyl (2R,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 134905097 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | methyl (2R,3R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=C[C@@H](C)[C@@H](NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H12F3NO3/c1-4-5(2)6(7(14)16-3)13-8(15)9(10,11)12/h4-6H,1H2,2-3H3,(H,13,15)/t5-,6-/m1/s1 |
| InChIKey | VIPOAUGIPHRJOU-PHDIDXHHSA-N |
| XLogP | 1.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|