C12H23NOSe — CID 134905174
(2S,3S)-3-hydroxy-2,3,4-trimethyl-1-pyrrolidin-1-ylpentane-1-selone (PubChem CID 134905174) has the molecular formula C12H23NOSe and a molecular weight of 276.28 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2,3,4-trimethyl-1-pyrrolidin-1-ylpentane-1-selone.
| Compound Name | (2S,3S)-3-hydroxy-2,3,4-trimethyl-1-pyrrolidin-1-ylpentane-1-selone |
|---|---|
| PubChem CID | 134905174 |
| Molecular Formula | C12H23NOSe |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (2S,3S)-3-hydroxy-2,3,4-trimethyl-1-pyrrolidin-1-ylpentane-1-selone |
| SMILES | CC(C)[C@](C)(O)[C@H](C)C(=[Se])N1CCCC1 |
| InChI | InChI=1S/C12H23NOSe/c1-9(2)12(4,14)10(3)11(15)13-7-5-6-8-13/h9-10,14H,5-8H2,1-4H3/t10-,12+/m1/s1 |
| InChIKey | NGZRDJLLMVNPDK-PWSUYJOCSA-N |
| XLogP | 1.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|