About ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate
ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate (PubChem CID 134905314) has the molecular formula C19H25NO4
and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate |
| PubChem CID | 134905314 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@@H]1CN([C@@H](C)c2ccccc2)C(=O)[C@H]1C(C)=O |
| InChI | InChI=1S/C19H25NO4/c1-5-24-19(23)12(2)16-11-20(18(22)17(16)14(4)21)13(3)15-9-7-6-8-10-15/h6-10,12-13,16-17H,5,11H2,1-4H3/t12-,13-,16-,17-/m0/s1 |
| InChIKey | RMGQPTBMGKJCAG-PYTWLRIVSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate?
The IUPAC name of ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate (CID 134905314) is ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate.
What is the SMILES notation for ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate?
The canonical SMILES for ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate is CCOC(=O)[C@@H](C)[C@@H]1CN([C@@H](C)c2ccccc2)C(=O)[C@H]1C(C)=O.
What is the InChIKey of ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate?
The InChIKey is RMGQPTBMGKJCAG-PYTWLRIVSA-N. The full InChI is InChI=1S/C19H25NO4/c1-5-24-19(23)12(2)16-11-20(18(22)17(16)14(4)21)13(3)15-9-7-6-8-10-15/h6-10,12-13,16-17H,5,11H2,1-4H3/t12-,13-,16-,17-/m0/s1.
What are the key properties of ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate?
ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate has a molecular weight of 331.41 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[(3R,4R)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate is sourced from PubChem (CID 134905314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).