About lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine
lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine (PubChem CID 134905341) has the molecular formula C11H16LiN
and a molecular weight of 169.20 g/mol. Its IUPAC name is lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine |
| PubChem CID | 134905341 |
| Molecular Formula | C11H16LiN |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine |
| SMILES | Cc1[c-]c(CN(C)C)cc(C)c1.[Li+] |
| InChI | InChI=1S/C11H16N.Li/c1-9-5-10(2)7-11(6-9)8-12(3)4;/h5-6H,8H2,1-4H3;/q-1;+1 |
| InChIKey | XZKSDXQBXXJJAF-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine?
The IUPAC name of lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine (CID 134905341) is lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine?
The canonical SMILES for lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine is Cc1[c-]c(CN(C)C)cc(C)c1.[Li+].
What is the InChIKey of lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine?
The InChIKey is XZKSDXQBXXJJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N.Li/c1-9-5-10(2)7-11(6-9)8-12(3)4;/h5-6H,8H2,1-4H3;/q-1;+1.
What are the key properties of lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine?
lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine has a molecular weight of 169.20 g/mol, XLogP of -0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-(3,5-dimethylbenzene-6-id-1-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 134905341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).