About (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one
(3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one (PubChem CID 134905344) has the molecular formula C17H15F3O2S
and a molecular weight of 340.37 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one.
Molecular Properties
| Compound Name | (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one |
| PubChem CID | 134905344 |
| Molecular Formula | C17H15F3O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one |
| SMILES | O=C(CC(C[S@](=O)c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H15F3O2S/c18-17(19,20)14(11-16(21)13-7-3-1-4-8-13)12-23(22)15-9-5-2-6-10-15/h1-10,14H,11-12H2/t14?,23-/m0/s1 |
| InChIKey | PAAWDNFXCZLKRV-AQJFCTLQSA-N |
| XLogP | 4.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one?
The IUPAC name of (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one (CID 134905344) is (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one.
What is the SMILES notation for (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one?
The canonical SMILES for (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one is O=C(CC(C[S@](=O)c1ccccc1)C(F)(F)F)c1ccccc1.
What is the InChIKey of (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one?
The InChIKey is PAAWDNFXCZLKRV-AQJFCTLQSA-N. The full InChI is InChI=1S/C17H15F3O2S/c18-17(19,20)14(11-16(21)13-7-3-1-4-8-13)12-23(22)15-9-5-2-6-10-15/h1-10,14H,11-12H2/t14?,23-/m0/s1.
What are the key properties of (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one?
(3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one has a molecular weight of 340.37 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4,4-trifluoro-1-phenyl-3-[[(S)-phenylsulfinyl]methyl]butan-1-one is sourced from PubChem (CID 134905344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).