About methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate
methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate (PubChem CID 134905371) has the molecular formula C28H36O3S2
and a molecular weight of 484.73 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate |
| PubChem CID | 134905371 |
| Molecular Formula | C28H36O3S2 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1C(=O)CC[C@H]1C(Sc1ccc(C)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C28H36O3S2/c1-20-10-14-22(15-11-20)32-28(33-23-16-12-21(2)13-17-23)25-18-19-26(29)24(25)8-6-4-5-7-9-27(30)31-3/h10-17,24-25,28H,4-9,18-19H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | DBRLSIMZMSZQNV-LOSJGSFVSA-N |
| XLogP | 7.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate (CID 134905371) is methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate is COC(=O)CCCCCC[C@@H]1C(=O)CC[C@H]1C(Sc1ccc(C)cc1)Sc1ccc(C)cc1.
What is the InChIKey of methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate?
The InChIKey is DBRLSIMZMSZQNV-LOSJGSFVSA-N. The full InChI is InChI=1S/C28H36O3S2/c1-20-10-14-22(15-11-20)32-28(33-23-16-12-21(2)13-17-23)25-18-19-26(29)24(25)8-6-4-5-7-9-27(30)31-3/h10-17,24-25,28H,4-9,18-19H2,1-3H3/t24-,25+/m0/s1.
What are the key properties of methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate?
methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate has a molecular weight of 484.73 g/mol, XLogP of 7.62, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate is sourced from PubChem (CID 134905371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).