C28H36O3S2 — CID 134905371
methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate (PubChem CID 134905371) has the molecular formula C28H36O3S2 and a molecular weight of 484.73 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 134905371 |
| Molecular Formula | C28H36O3S2 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | methyl 7-[(1S,2R)-2-[bis[(4-methylphenyl)sulfanyl]methyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1C(=O)CC[C@H]1C(Sc1ccc(C)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C28H36O3S2/c1-20-10-14-22(15-11-20)32-28(33-23-16-12-21(2)13-17-23)25-18-19-26(29)24(25)8-6-4-5-7-9-27(30)31-3/h10-17,24-25,28H,4-9,18-19H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | DBRLSIMZMSZQNV-LOSJGSFVSA-N |
| XLogP | 7.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|