C18H33LiO4Si — CID 134905412
lithium [(4aR,8R,8aR)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-id-8-yl]oxy-tri(propan-2-yl)silane (PubChem CID 134905412) has the molecular formula C18H33LiO4Si and a molecular weight of 348.49 g/mol. Its IUPAC name is lithium [(4aR,8R,8aR)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-id-8-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | lithium [(4aR,8R,8aR)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-id-8-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134905412 |
| Molecular Formula | C18H33LiO4Si |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | lithium [(4aR,8R,8aR)-2,2-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-id-8-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1C=[C-]O[C@@H]2COC(C)(C)O[C@@H]12)(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C18H33O4Si.Li/c1-12(2)23(13(3)4,14(5)6)22-15-9-10-19-16-11-20-18(7,8)21-17(15)16;/h9,12-17H,11H2,1-8H3;/q-1;+1/t15-,16-,17+;/m1./s1 |
| InChIKey | UIDUYIPEXIKFGX-QEFLZESTSA-N |
| XLogP | 1.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|