C36H39NO6 — CID 134905440
N-[(2S,3R,4R,5S,6R)-2-[hydroxy(phenyl)methyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 134905440) has the molecular formula C36H39NO6 and a molecular weight of 581.71 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-2-[hydroxy(phenyl)methyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-2-[hydroxy(phenyl)methyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 134905440 |
| Molecular Formula | C36H39NO6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2-[hydroxy(phenyl)methyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1C(O)c1ccccc1 |
| InChI | InChI=1S/C36H39NO6/c1-26(38)37-32-35(33(39)30-20-12-5-13-21-30)43-31(25-40-22-27-14-6-2-7-15-27)34(41-23-28-16-8-3-9-17-28)36(32)42-24-29-18-10-4-11-19-29/h2-21,31-36,39H,22-25H2,1H3,(H,37,38)/t31-,32+,33?,34-,35+,36-/m1/s1 |
| InChIKey | IPRVJWSUELDGAN-NMUYQOQVSA-N |
| XLogP | 5.38 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |