C29H27NO — CID 134905488
[(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-phenylmethanol (PubChem CID 134905488) has the molecular formula C29H27NO and a molecular weight of 405.54 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-phenylmethanol.
| Compound Name | [(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 134905488 |
| Molecular Formula | C29H27NO |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [(2S,3S)-3-methyl-1-tritylaziridin-2-yl]-phenylmethanol |
| SMILES | C[C@H]1[C@@H](C(O)c2ccccc2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27NO/c1-22-27(28(31)23-14-6-2-7-15-23)30(22)29(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-22,27-28,31H,1H3/t22-,27-,28?,30?/m0/s1 |
| InChIKey | GRMOCEQLAFXMAH-VHBFLMSNSA-N |
| XLogP | 5.78 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|