C20H42O2Si2 — CID 134905693
[(1R,3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134905693) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is [(1R,3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134905693 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [(1R,3aR,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C20H42O2Si2/c1-19(2,3)23(7,8)21-16-13-15-11-12-18(17(15)14-16)22-24(9,10)20(4,5)6/h15-18H,11-14H2,1-10H3/t15-,16+,17+,18-/m1/s1 |
| InChIKey | OOHFRKIXWGNZGP-VSZNYVQBSA-N |
| XLogP | 6.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|