C18H28O5 — CID 134905755
methyl (1S,4aS,5S,8aS)-4a-methyl-5-(oxan-2-yloxy)-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 134905755) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (1S,4aS,5S,8aS)-4a-methyl-5-(oxan-2-yloxy)-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5S,8aS)-4a-methyl-5-(oxan-2-yloxy)-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134905755 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | methyl (1S,4aS,5S,8aS)-4a-methyl-5-(oxan-2-yloxy)-2-oxo-1,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)CC[C@]2(C)[C@@H](OC3CCCCO3)CCC[C@@H]12 |
| InChI | InChI=1S/C18H28O5/c1-18-10-9-13(19)16(17(20)21-2)12(18)6-5-7-14(18)23-15-8-3-4-11-22-15/h12,14-16H,3-11H2,1-2H3/t12-,14-,15?,16-,18-/m0/s1 |
| InChIKey | KJJJCLYPGBCEEL-FQAWKJHUSA-N |
| XLogP | 2.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|