C20H42O2Si — CID 134905781
tert-butyl-[2-[(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-dimethylsilane (PubChem CID 134905781) has the molecular formula C20H42O2Si and a molecular weight of 342.64 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-dimethylsilane |
|---|---|
| PubChem CID | 134905781 |
| Molecular Formula | C20H42O2Si |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | tert-butyl-[2-[(4S,6S)-6-hexyl-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-dimethylsilane |
| SMILES | CCCCCC[C@H]1C[C@@H](CC[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C20H42O2Si/c1-9-10-11-12-13-17-16-18(22-20(5,6)21-17)14-15-23(7,8)19(2,3)4/h17-18H,9-16H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | HWCJMTCRVKJLOC-ZWKOTPCHSA-N |
| XLogP | 6.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|