C17H22OS — CID 134905809
(3R,4aS,8aS)-4a-methyl-3-phenylsulfanyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 134905809) has the molecular formula C17H22OS and a molecular weight of 274.43 g/mol. Its IUPAC name is (3R,4aS,8aS)-4a-methyl-3-phenylsulfanyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (3R,4aS,8aS)-4a-methyl-3-phenylsulfanyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 134905809 |
| Molecular Formula | C17H22OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3R,4aS,8aS)-4a-methyl-3-phenylsulfanyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | C[C@@]12CCCC[C@H]1CC(=O)[C@H](Sc1ccccc1)C2 |
| InChI | InChI=1S/C17H22OS/c1-17-10-6-5-7-13(17)11-15(18)16(12-17)19-14-8-3-2-4-9-14/h2-4,8-9,13,16H,5-7,10-12H2,1H3/t13-,16+,17-/m0/s1 |
| InChIKey | ZXCLHJLQGSDUNF-XKQJLSEDSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |