C17H28O4 — CID 134905811
[2-(2-ethoxyethyl)-5,5-dimethyl-3-oxo-4-propan-2-ylcyclohexen-1-yl] acetate (PubChem CID 134905811) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [2-(2-ethoxyethyl)-5,5-dimethyl-3-oxo-4-propan-2-ylcyclohexen-1-yl] acetate.
| Compound Name | [2-(2-ethoxyethyl)-5,5-dimethyl-3-oxo-4-propan-2-ylcyclohexen-1-yl] acetate |
|---|---|
| PubChem CID | 134905811 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [2-(2-ethoxyethyl)-5,5-dimethyl-3-oxo-4-propan-2-ylcyclohexen-1-yl] acetate |
| SMILES | CCOCCC1=C(OC(C)=O)CC(C)(C)C(C(C)C)C1=O |
| InChI | InChI=1S/C17H28O4/c1-7-20-9-8-13-14(21-12(4)18)10-17(5,6)15(11(2)3)16(13)19/h11,15H,7-10H2,1-6H3 |
| InChIKey | ZKZPVQUNGBLABR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|