C14H29NO2 — CID 134905813
(2S,4R)-4-hydroxy-2,5-dimethyl-N,N-di(propan-2-yl)hexanamide (PubChem CID 134905813) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-2,5-dimethyl-N,N-di(propan-2-yl)hexanamide.
| Compound Name | (2S,4R)-4-hydroxy-2,5-dimethyl-N,N-di(propan-2-yl)hexanamide |
|---|---|
| PubChem CID | 134905813 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (2S,4R)-4-hydroxy-2,5-dimethyl-N,N-di(propan-2-yl)hexanamide |
| SMILES | CC(C)[C@H](O)C[C@H](C)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H29NO2/c1-9(2)13(16)8-12(7)14(17)15(10(3)4)11(5)6/h9-13,16H,8H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | LGDJGLKGWNYYNG-QWHCGFSZSA-N |
| XLogP | 2.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |