C22H33NO4 — CID 134905839
methyl (3R,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-3,4-dimethyl-5-oxopentanoate (PubChem CID 134905839) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is methyl (3R,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-3,4-dimethyl-5-oxopentanoate.
| Compound Name | methyl (3R,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-3,4-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 134905839 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | methyl (3R,4R)-5-[(4S)-4-benzyl-2,2,5,5-tetramethyl-1,3-oxazolidin-3-yl]-3,4-dimethyl-5-oxopentanoate |
| SMILES | COC(=O)C[C@@H](C)[C@@H](C)C(=O)N1[C@@H](Cc2ccccc2)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C22H33NO4/c1-15(13-19(24)26-7)16(2)20(25)23-18(14-17-11-9-8-10-12-17)21(3,4)27-22(23,5)6/h8-12,15-16,18H,13-14H2,1-7H3/t15-,16-,18+/m1/s1 |
| InChIKey | VJKGRIQKKBOQMT-NUJGCVRESA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |