C22H36O4Si — CID 134905895
(4R,7aS)-4-[(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-en-3-yl]-4,7a-dimethyl-6,7-dihydro-2-benzofuran-1,5-dione (PubChem CID 134905895) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is (4R,7aS)-4-[(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-en-3-yl]-4,7a-dimethyl-6,7-dihydro-2-benzofuran-1,5-dione.
| Compound Name | (4R,7aS)-4-[(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-en-3-yl]-4,7a-dimethyl-6,7-dihydro-2-benzofuran-1,5-dione |
|---|---|
| PubChem CID | 134905895 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (4R,7aS)-4-[(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-en-3-yl]-4,7a-dimethyl-6,7-dihydro-2-benzofuran-1,5-dione |
| SMILES | C=C[C@@H]([C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)CC[C@]2(C)C(=O)OC=C21 |
| InChI | InChI=1S/C22H36O4Si/c1-10-16(15(2)13-26-27(8,9)20(3,4)5)22(7)17-14-25-19(24)21(17,6)12-11-18(22)23/h10,14-16H,1,11-13H2,2-9H3/t15-,16-,21-,22+/m0/s1 |
| InChIKey | MGWDVXUMMLCYNS-WWLNLUSPSA-N |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|