C14H28O2 — CID 134905987
(E)-2,2,9,9-tetramethyldec-5-ene-3,8-diol (PubChem CID 134905987) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (E)-2,2,9,9-tetramethyldec-5-ene-3,8-diol.
| Compound Name | (E)-2,2,9,9-tetramethyldec-5-ene-3,8-diol |
|---|---|
| PubChem CID | 134905987 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (E)-2,2,9,9-tetramethyldec-5-ene-3,8-diol |
| SMILES | CC(C)(C)C(O)C/C=C/CC(O)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-13(2,3)11(15)9-7-8-10-12(16)14(4,5)6/h7-8,11-12,15-16H,9-10H2,1-6H3/b8-7+ |
| InChIKey | CWOXCUHSVCLEOT-BQYQJAHWSA-N |
| XLogP | 3.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|