C17H30O2Si — CID 134906204
cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,3-dimethylbut-1-ynyl)cyclopentan-1-one (PubChem CID 134906204) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,3-dimethylbut-1-ynyl)cyclopentan-1-one.
| Compound Name | cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,3-dimethylbut-1-ynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 134906204 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | cis-(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,3-dimethylbut-1-ynyl)cyclopentan-1-one |
| SMILES | CC(C)(C)C#C[C@@H]1CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O2Si/c1-16(2,3)10-9-13-11-14(18)12-15(13)19-20(7,8)17(4,5)6/h13,15H,11-12H2,1-8H3/t13-,15-/m1/s1 |
| InChIKey | WJKNKXWHSIKWBF-UKRRQHHQSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|