About 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane
2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane (PubChem CID 134906322) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane.
Molecular Properties
| Compound Name | 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane |
| PubChem CID | 134906322 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane |
| SMILES | CC1=C(CC/C=C\CCOC2CCCCO2)CCC[C@H]1C |
| InChI | InChI=1S/C19H32O2/c1-16-10-9-12-18(17(16)2)11-5-3-4-7-14-20-19-13-6-8-15-21-19/h3-4,16,19H,5-15H2,1-2H3/b4-3-/t16-,19?/m1/s1 |
| InChIKey | NZSPVHKGMJPFQP-ZUNQZDIFSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane?
The IUPAC name of 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane (CID 134906322) is 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane.
What is the SMILES notation for 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane?
The canonical SMILES for 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane is CC1=C(CC/C=C\CCOC2CCCCO2)CCC[C@H]1C.
What is the InChIKey of 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane?
The InChIKey is NZSPVHKGMJPFQP-ZUNQZDIFSA-N. The full InChI is InChI=1S/C19H32O2/c1-16-10-9-12-18(17(16)2)11-5-3-4-7-14-20-19-13-6-8-15-21-19/h3-4,16,19H,5-15H2,1-2H3/b4-3-/t16-,19?/m1/s1.
What are the key properties of 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane?
2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane has a molecular weight of 292.46 g/mol, XLogP of 5.39, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-6-[(3R)-2,3-dimethylcyclohexen-1-yl]hex-3-enoxy]oxane is sourced from PubChem (CID 134906322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).