C17H30OS2 — CID 134906349
(2E,6Z,10Z)-3,11-dimethyl-13-sulfanyl-7-(2-sulfanylethyl)trideca-2,6,10-trien-1-ol (PubChem CID 134906349) has the molecular formula C17H30OS2 and a molecular weight of 314.56 g/mol. Its IUPAC name is (2E,6Z,10Z)-3,11-dimethyl-13-sulfanyl-7-(2-sulfanylethyl)trideca-2,6,10-trien-1-ol.
| Compound Name | (2E,6Z,10Z)-3,11-dimethyl-13-sulfanyl-7-(2-sulfanylethyl)trideca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 134906349 |
| Molecular Formula | C17H30OS2 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2E,6Z,10Z)-3,11-dimethyl-13-sulfanyl-7-(2-sulfanylethyl)trideca-2,6,10-trien-1-ol |
| SMILES | C/C(=C/CC/C(=C/CC/C(C)=C/CO)CCS)CCS |
| InChI | InChI=1S/C17H30OS2/c1-15(9-12-18)5-3-7-17(11-14-20)8-4-6-16(2)10-13-19/h6-7,9,18-20H,3-5,8,10-14H2,1-2H3/b15-9+,16-6-,17-7- |
| InChIKey | ANNKVIQMFZVGQA-HGXOYRCUSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|