About 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole
5-methoxy-1-methyl-2,3,4,7-tetrahydroindole (PubChem CID 134906377) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole.
Molecular Properties
| Compound Name | 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole |
| PubChem CID | 134906377 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole |
| SMILES | COC1=CCC2=C(CCN2C)C1 |
| InChI | InChI=1S/C10H15NO/c1-11-6-5-8-7-9(12-2)3-4-10(8)11/h3H,4-7H2,1-2H3 |
| InChIKey | HUVHJILCFDJWQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole?
The IUPAC name of 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole (CID 134906377) is 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole.
What is the SMILES notation for 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole?
The canonical SMILES for 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole is COC1=CCC2=C(CCN2C)C1.
What is the InChIKey of 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole?
The InChIKey is HUVHJILCFDJWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-11-6-5-8-7-9(12-2)3-4-10(8)11/h3H,4-7H2,1-2H3.
What are the key properties of 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole?
5-methoxy-1-methyl-2,3,4,7-tetrahydroindole has a molecular weight of 165.24 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-methyl-2,3,4,7-tetrahydroindole is sourced from PubChem (CID 134906377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).