C34H70B2Sn — CID 134906397
[(2S,5R)-5-diethylboranyl-2,5-diethyl-1,1-dimethyl-3,4-dioctylstannol-2-yl]-diethylborane (PubChem CID 134906397) has the molecular formula C34H70B2Sn and a molecular weight of 619.27 g/mol. Its IUPAC name is [(2S,5R)-5-diethylboranyl-2,5-diethyl-1,1-dimethyl-3,4-dioctylstannol-2-yl]-diethylborane.
| Compound Name | [(2S,5R)-5-diethylboranyl-2,5-diethyl-1,1-dimethyl-3,4-dioctylstannol-2-yl]-diethylborane |
|---|---|
| PubChem CID | 134906397 |
| Molecular Formula | C34H70B2Sn |
| Molecular Weight | 619.27 g/mol |
| Exact Mass | 620.47 |
| IUPAC Name | [(2S,5R)-5-diethylboranyl-2,5-diethyl-1,1-dimethyl-3,4-dioctylstannol-2-yl]-diethylborane |
| SMILES | CCCCCCCCC1=C(CCCCCCCC)[C@@](CC)(B(CC)CC)[Sn](C)(C)[C@@]1(CC)B(CC)CC |
| InChI | InChI=1S/C32H64B2.2CH3.Sn/c1-9-17-19-21-23-25-27-29(31(11-3)33(13-5)14-6)30(28-26-24-22-20-18-10-2)32(12-4)34(15-7)16-8;;;/h9-28H2,1-8H3;2*1H3;/b30-29-;;; |
| InChIKey | AOEXGMPLSYDEPD-SKSVTKFBSA-N |
| XLogP | 12.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.27 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|