C15H21BO — CID 134906403
(4Z,6Z,8Z)-1-cyclopentyl-3-methyl-3a,9a-dihydro-3H-cycloocta[c]oxaborole (PubChem CID 134906403) has the molecular formula C15H21BO and a molecular weight of 228.14 g/mol. Its IUPAC name is (4Z,6Z,8Z)-1-cyclopentyl-3-methyl-3a,9a-dihydro-3H-cycloocta[c]oxaborole.
| Compound Name | (4Z,6Z,8Z)-1-cyclopentyl-3-methyl-3a,9a-dihydro-3H-cycloocta[c]oxaborole |
|---|---|
| PubChem CID | 134906403 |
| Molecular Formula | C15H21BO |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (4Z,6Z,8Z)-1-cyclopentyl-3-methyl-3a,9a-dihydro-3H-cycloocta[c]oxaborole |
| SMILES | CC1OB(C2CCCC2)C2/C=C\C=C/C=C\C12 |
| InChI | InChI=1S/C15H21BO/c1-12-14-10-4-2-3-5-11-15(14)16(17-12)13-8-6-7-9-13/h2-5,10-15H,6-9H2,1H3/b3-2-,10-4-,11-5- |
| InChIKey | LXRHSOHBFYKVCG-CVYMTVGLSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|