About 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one
1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one (PubChem CID 134906653) has the molecular formula C17H13NO3S
and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one |
| PubChem CID | 134906653 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one |
| SMILES | O=C1CCc2cc3ccn(S(=O)(=O)c4ccccc4)c3cc21 |
| InChI | InChI=1S/C17H13NO3S/c19-17-7-6-12-10-13-8-9-18(16(13)11-15(12)17)22(20,21)14-4-2-1-3-5-14/h1-5,8-11H,6-7H2 |
| InChIKey | YDGYBMQKCXBHEB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one?
The IUPAC name of 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one (CID 134906653) is 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one.
What is the SMILES notation for 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one?
The canonical SMILES for 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one is O=C1CCc2cc3ccn(S(=O)(=O)c4ccccc4)c3cc21.
What is the InChIKey of 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one?
The InChIKey is YDGYBMQKCXBHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3S/c19-17-7-6-12-10-13-8-9-18(16(13)11-15(12)17)22(20,21)14-4-2-1-3-5-14/h1-5,8-11H,6-7H2.
What are the key properties of 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one?
1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one has a molecular weight of 311.36 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-5,6-dihydrocyclopenta[f]indol-7-one is sourced from PubChem (CID 134906653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).