About CID 134906925
CID 134906925 (PubChem CID 134906925) has the molecular formula C13H19CoP2
and a molecular weight of 296.18 g/mol.
Molecular Properties
| Compound Name | CID 134906925 |
| PubChem CID | 134906925 |
| Molecular Formula | C13H19CoP2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | — |
| SMILES | CC(C)C1=PC(C(C)C)=P1.[CH]1C=CC=C1.[Co] |
| InChI | InChI=1S/C8H14P2.C5H5.Co/c1-5(2)7-9-8(10-7)6(3)4;1-2-4-5-3-1;/h5-6H,1-4H3;1-5H; |
| InChIKey | FVVMCYAJUJLPLO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134906925 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134906925?
The IUPAC name of CID 134906925 (CID 134906925) is not available.
What is the SMILES notation for CID 134906925?
The canonical SMILES for CID 134906925 is CC(C)C1=PC(C(C)C)=P1.[CH]1C=CC=C1.[Co].
What is the InChIKey of CID 134906925?
The InChIKey is FVVMCYAJUJLPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14P2.C5H5.Co/c1-5(2)7-9-8(10-7)6(3)4;1-2-4-5-3-1;/h5-6H,1-4H3;1-5H;.
What are the key properties of CID 134906925?
CID 134906925 has a molecular weight of 296.18 g/mol, XLogP of 4.78, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134906925 is sourced from PubChem (CID 134906925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).