C22H27NO3S — CID 134907367
(4S,5S)-4-(4-methylphenyl)sulfonyl-5-(6-phenylhexyl)-4,5-dihydro-1,3-oxazole (PubChem CID 134907367) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(6-phenylhexyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(6-phenylhexyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134907367 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (4S,5S)-4-(4-methylphenyl)sulfonyl-5-(6-phenylhexyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2N=CO[C@H]2CCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-18-13-15-20(16-14-18)27(24,25)22-21(26-17-23-22)12-8-3-2-5-9-19-10-6-4-7-11-19/h4,6-7,10-11,13-17,21-22H,2-3,5,8-9,12H2,1H3/t21-,22-/m0/s1 |
| InChIKey | WXFKFXSINVZSLW-VXKWHMMOSA-N |
| XLogP | 4.72 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|