C17H25NO3S — CID 134907434
(4S,5S)-5-heptyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole (PubChem CID 134907434) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (4S,5S)-5-heptyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-5-heptyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134907434 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (4S,5S)-5-heptyl-4-(4-methylphenyl)sulfonyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCC[C@@H]1OC=N[C@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-3-4-5-6-7-8-16-17(18-13-21-16)22(19,20)15-11-9-14(2)10-12-15/h9-13,16-17H,3-8H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | QIDDLSKITYZOOG-IRXDYDNUSA-N |
| XLogP | 3.88 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|